Pigment yellow 65 – Corimax Yellow RN
Technical parameters of Pigment yellow 65
| Kleurindexnr. | Pigment geel 65 |
| Productnaam | Corimax Yellow RN |
| Product categorie | Organisch Pigment |
| CAS-nummer | 6528-34-3 |
| EU-nummer | 229-419-9 |
| Chemische familie | Monazo |
| Molecuulgewicht | 386.36 |
| Moleculaire formule | C18H18N4O6 |
| PH waarde | 6.0-7.0 |
| Dichtheid | 1.6 |
| Olie-absorptie (ml / 100 g)% | 35-45 |
| Lichtechtheid (coating) | 7 |
| Hittebestendigheid (coating) | 140 |
| Waterbestendigheid | 5 |
| Olie weerstand | 3 |
| Zuurbestendigheid | 5 |
| Alkali-weerstand | 5 |
Kleur | ![]() |
| Tint distributie |
Kenmerken: Good dispersion.
Toepassing:
Recommended for architectural coatings, industrial coatings.
Gerelateerde informatie
Pigment Yellow 65 is a high-performance, bright yellow pigment widely used in coatings, inks, plastics, and paints. It offers excellent lightfastness, weather resistance, and chemical stability, making it suitable for both indoor and outdoor applications. Known for its vibrant, clean yellow hue, it provides strong color strength and opacity, ensuring high-quality results. Pigment Yellow 65 is particularly popular in automotive coatings, printing inks, and industrial applications where durability and consistency are crucial. With its non-toxic and environmentally friendly properties, it is a reliable choice for manufacturers seeking long-lasting and vivid yellow colors.
Moleculaire structuur:
Molecular Formula:C18H18N4O6
Molecular Weight: 386.36
CAS Registry Number:6528-34-3
Manufacturing Methods : 4-Methoxy-2-nitrobenzenamine diazotization, and N-(2-methoxyphenyl)-3-oxobutanamide coupling.
Properties and Applications:brilliant red light yellow. Red powder. Sunlight fastness is better. Resistance to Cellosole, kerosene, is not able to bear or endure xylene, acid-proof alkaline better. In oily medium, especially in latex coating in use, also can be used for coating, rubber, cultural and educational supplies coloring.
Structural Identifiers
IUPAC Name: 2-[(4-Methoxy-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide
SMILES: COC1=CC(=C(C=C1)N=NC(C(C)=O)C(=O)NC1=C(OC)C=CC=C1)[N+]([O-])=O
InChI String: InChI=1/C18H18N4O6/c1-11(23)17(18(24)19-14-6-4-5-7-16(14)28-3)21-20-13-9-8-12(27-2)10-15(13)22(25)26/h4-10,17H,1-3H3,(H,19,24)
InChIKey: UFORAEIAYCSGCR-UHFFFAOYSA-N
Synoniemen
| 6528-34-3 |
| Permanent Yellow Rn |
| YELLOW65 |
| 2-[(4-methoxy-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide |
| Butanamide,2-[(4-methoxy-2-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxo- |
| Butanamide, 2-((4-methoxy-2-nitrophenyl)azo)-N-(2-methoxyphenyl)-3-oxo- |
| Butanamide, 2-[(4-methoxy-2-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxo- |
| 2-[2-(4-METHOXY-2-NITROPHENYL)DIAZEN-1-YL]-N-(2-METHOXYPHENYL)-3-OXOBUTANAMIDE |
| EINECS 229-419-9 |
| EC 229-419-9 |
| SCHEMBL6928762 |
| 2-((4-Methoxy-2-nitrophenyl)azo)-o-acetoacetanisidide |
| DTXSID0052336 |
| SCHEMBL12760851 |
| UFORAEIAYCSGCR-UHFFFAOYSA-N |
| HY-D1204 |
| MFCD00071941 |
| AKOS037643608 |
| Butanamide, 2-(2-(4-methoxy-2-nitrophenyl)diazenyl)-N-(2-methoxyphenyl)-3-oxo- |
| AS-17500 |
| CS-0143082 |
| NS00003477 |
| EN300-207584 |
| 2-((4-Methoxy-2-nitrophenyl)azo)-N-(2-methoxyphenyl)-3-oxobutyramide |
| (E)-2-((4-methoxy-2-nitrophenyl)diazenyl)-N-(2-methoxyphenyl)-3-oxobutanamide |
Berekende eigenschappen
| Eigendomsnaam | Eigendoms-waarde |
| Molecuulgewicht | 386.4 g/mol |
| XLogP3-AA | 3.3 |
| Aantal waterstofobligatiedonoren | 1 |
| Aantal waterstofbrugacceptoren | 8 |
| Draaibare bindingtelling | 7 |
| Exacte massa | 386.12263431 Da |
| Mono-isotopische massa | 386.12263431 Da |
| Topologisch polair oppervlak | 135 Ų |
| Zware atoomtelling | 28 |
| Formele aanklacht | 0 |
| Complexiteit | 593 |
| Aantal isotopenatomen | 0 |
| Gedefinieerd aantal atomen in stereocentra | 0 |
| Ongedefinieerd aantal atomaire stereocentra | 1 |
| Gedefinieerde Bond Stereocenter-telling | 0 |
| Ongedefinieerde Bond Stereocenter-telling | 0 |
| Aantal covalent gebonden eenheden | 1 |
| Verbinding is gecanoniseerd | Ja |











